C23H31N3O5S — CID 31686539
3-(diethylsulfamoyl)-N-[2-[3-(3-methylphenoxy)propylamino]-2-oxoethyl]benzamide (PubChem CID 31686539) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[2-[3-(3-methylphenoxy)propylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[2-[3-(3-methylphenoxy)propylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 31686539 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[2-[3-(3-methylphenoxy)propylamino]-2-oxoethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NCC(=O)NCCCOc2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H31N3O5S/c1-4-26(5-2)32(29,30)21-12-7-10-19(16-21)23(28)25-17-22(27)24-13-8-14-31-20-11-6-9-18(3)15-20/h6-7,9-12,15-16H,4-5,8,13-14,17H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | KLEHUABTGDEBLY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|