C24H29N3O3 — CID 31688003
2-[4-[[(2R)-4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]butyl]isoindole-1,3-dione (PubChem CID 31688003) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[4-[[(2R)-4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[(2R)-4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 31688003 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[4-[[(2R)-4-ethyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]butyl]isoindole-1,3-dione |
| SMILES | CCN1C[C@@H](CN(C)CCCCN2C(=O)c3ccccc3C2=O)Oc2ccccc21 |
| InChI | InChI=1S/C24H29N3O3/c1-3-26-17-18(30-22-13-7-6-12-21(22)26)16-25(2)14-8-9-15-27-23(28)19-10-4-5-11-20(19)24(27)29/h4-7,10-13,18H,3,8-9,14-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | UWYIVKCWRLPDGQ-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|