C17H24FN3O — CID 31688904
(2R)-N-cyclopropyl-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propanamide (PubChem CID 31688904) has the molecular formula C17H24FN3O and a molecular weight of 305.40 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 31688904 |
| Molecular Formula | C17H24FN3O |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC1CC1)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H24FN3O/c1-13(17(22)19-15-6-7-15)21-10-8-20(9-11-21)12-14-4-2-3-5-16(14)18/h2-5,13,15H,6-12H2,1H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | SSFBZMWZZCYFBW-CYBMUJFWSA-N |
| XLogP | 1.61 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |