C18H20N2O2S — CID 31697369
N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-carboxamide (PubChem CID 31697369) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31697369 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H](C(=O)N1CCCCC1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H20N2O2S/c21-17(15-10-7-13-23-15)19-16(14-8-3-1-4-9-14)18(22)20-11-5-2-6-12-20/h1,3-4,7-10,13,16H,2,5-6,11-12H2,(H,19,21)/t16-/m0/s1 |
| InChIKey | YAUOPOXZRZFOAH-INIZCTEOSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |