C18H12F3IN2OS — CID 31701324
N-(2-iodophenyl)-2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide (PubChem CID 31701324) has the molecular formula C18H12F3IN2OS and a molecular weight of 488.27 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2-iodophenyl)-2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 31701324 |
| Molecular Formula | C18H12F3IN2OS |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | N-(2-iodophenyl)-2-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(-c2ccc(C(F)(F)F)cc2)n1)Nc1ccccc1I |
| InChI | InChI=1S/C18H12F3IN2OS/c19-18(20,21)12-7-5-11(6-8-12)17-23-13(10-26-17)9-16(25)24-15-4-2-1-3-14(15)22/h1-8,10H,9H2,(H,24,25) |
| InChIKey | YEMSAOUPJJEXHU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|