C21H25N5O2S — CID 3170481
N-(2,4-dimethylphenyl)-2-[[4-(3-methoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3170481) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[[4-(3-methoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[[4-(3-methoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3170481 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[[4-(3-methoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COCCCn1c(SCC(=O)Nc2ccc(C)cc2C)nnc1-c1ccncc1 |
| InChI | InChI=1S/C21H25N5O2S/c1-15-5-6-18(16(2)13-15)23-19(27)14-29-21-25-24-20(17-7-9-22-10-8-17)26(21)11-4-12-28-3/h5-10,13H,4,11-12,14H2,1-3H3,(H,23,27) |
| InChIKey | ISHVJKOBHSOFQI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|