About ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate
ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate (PubChem CID 3170946) has the molecular formula C23H25N3O4
and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate |
| PubChem CID | 3170946 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)C(c2cc3cc(C)c(C)cc3[nH]c2=O)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C23H25N3O4/c1-5-7-18-20(23(28)29-6-2)19(16(11-24)21(25)30-18)15-10-14-8-12(3)13(4)9-17(14)26-22(15)27/h8-10,19H,5-7,25H2,1-4H3,(H,26,27) |
| InChIKey | ZLVWPXVOMNSVSK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate?
The IUPAC name of ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate (CID 3170946) is ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate.
What is the SMILES notation for ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate?
The canonical SMILES for ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate is CCCC1=C(C(=O)OCC)C(c2cc3cc(C)c(C)cc3[nH]c2=O)C(C#N)=C(N)O1.
What is the InChIKey of ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate?
The InChIKey is ZLVWPXVOMNSVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O4/c1-5-7-18-20(23(28)29-6-2)19(16(11-24)21(25)30-18)15-10-14-8-12(3)13(4)9-17(14)26-22(15)27/h8-10,19H,5-7,25H2,1-4H3,(H,26,27).
What are the key properties of ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate?
ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate has a molecular weight of 407.47 g/mol, XLogP of 3.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-amino-5-cyano-4-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)-2-propyl-4H-pyran-3-carboxylate is sourced from PubChem (CID 3170946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).