C16H15N3O5 — CID 31732776
4-[2-(2-methyl-3-nitroanilino)-2-oxoethoxy]benzamide (PubChem CID 31732776) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 4-[2-(2-methyl-3-nitroanilino)-2-oxoethoxy]benzamide.
| Compound Name | 4-[2-(2-methyl-3-nitroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 31732776 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-[2-(2-methyl-3-nitroanilino)-2-oxoethoxy]benzamide |
| SMILES | Cc1c(NC(=O)COc2ccc(C(N)=O)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N3O5/c1-10-13(3-2-4-14(10)19(22)23)18-15(20)9-24-12-7-5-11(6-8-12)16(17)21/h2-8H,9H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | KZKNITCNLHPEER-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|