C21H19ClN2O2S — CID 3173521
2-chloro-N-(oxolan-2-ylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 3173521) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is 2-chloro-N-(oxolan-2-ylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-N-(oxolan-2-ylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3173521 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-chloro-N-(oxolan-2-ylmethyl)-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(c1ccccc1Cl)N(CC1CCCO1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H19ClN2O2S/c22-18-11-5-4-10-17(18)20(25)24(13-16-9-6-12-26-16)21-23-19(14-27-21)15-7-2-1-3-8-15/h1-5,7-8,10-11,14,16H,6,9,12-13H2 |
| InChIKey | PYRCZTBJVNHNCJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |