C25H30N2O3S — CID 3175112
4'-(4-methoxyphenyl)-6,6,8'-trimethyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol (PubChem CID 3175112) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is 4'-(4-methoxyphenyl)-6,6,8'-trimethyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol.
| Compound Name | 4'-(4-methoxyphenyl)-6,6,8'-trimethyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
|---|---|
| PubChem CID | 3175112 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4'-(4-methoxyphenyl)-6,6,8'-trimethyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
| SMILES | C=CCSC1=NC2(CC(c3ccc(OC)cc3)c3ccc(O)c(C)c3O2)CC(C)(C)N1 |
| InChI | InChI=1S/C25H30N2O3S/c1-6-13-31-23-26-24(3,4)15-25(27-23)14-20(17-7-9-18(29-5)10-8-17)19-11-12-21(28)16(2)22(19)30-25/h6-12,20,28H,1,13-15H2,2-5H3,(H,26,27) |
| InChIKey | RYQIQTFWSRHYSV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|