C23H28N2O3S — CID 3175113
4'-(4-methoxyphenyl)-5',6,6-trimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol (PubChem CID 3175113) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4'-(4-methoxyphenyl)-5',6,6-trimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol.
| Compound Name | 4'-(4-methoxyphenyl)-5',6,6-trimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
|---|---|
| PubChem CID | 3175113 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4'-(4-methoxyphenyl)-5',6,6-trimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
| SMILES | COc1ccc(C2CC3(CC(C)(C)NC(SC)=N3)Oc3cc(O)cc(C)c32)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-14-10-16(26)11-19-20(14)18(15-6-8-17(27-4)9-7-15)12-23(28-19)13-22(2,3)24-21(25-23)29-5/h6-11,18,26H,12-13H2,1-5H3,(H,24,25) |
| InChIKey | AUXILRFLUXGQNZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |