C22H29N7O — CID 3175198
3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one (PubChem CID 3175198) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3175198 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-8-methyl-1H-quinolin-2-one |
| SMILES | Cc1cccc2cc(C(c3nnnn3C3CCCC3)N3CCN(C)CC3)c(=O)[nH]c12 |
| InChI | InChI=1S/C22H29N7O/c1-15-6-5-7-16-14-18(22(30)23-19(15)16)20(28-12-10-27(2)11-13-28)21-24-25-26-29(21)17-8-3-4-9-17/h5-7,14,17,20H,3-4,8-13H2,1-2H3,(H,23,30) |
| InChIKey | OZBYXDMMXNJHFB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |