C25H23N3O4S — CID 3175598
1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(1-phenylethyl)thiourea (PubChem CID 3175598) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(1-phenylethyl)thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3175598 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(1-phenylethyl)thiourea |
| SMILES | CC(NC(=S)N(Cc1ccco1)Cc1cc2cc3c(cc2[nH]c1=O)OCO3)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-16(17-6-3-2-4-7-17)26-25(33)28(14-20-8-5-9-30-20)13-19-10-18-11-22-23(32-15-31-22)12-21(18)27-24(19)29/h2-12,16H,13-15H2,1H3,(H,26,33)(H,27,29) |
| InChIKey | HSUFZQCCBIXTGE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|