C23H24N4O4S — CID 3175625
1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 3175625) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3175625 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-3-(oxolan-2-ylmethyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(Cc1cccnc1)C(=S)NCC1CCCO1)OCO3 |
| InChI | InChI=1S/C23H24N4O4S/c28-22-17(7-16-8-20-21(31-14-30-20)9-19(16)26-22)13-27(12-15-3-1-5-24-10-15)23(32)25-11-18-4-2-6-29-18/h1,3,5,7-10,18H,2,4,6,11-14H2,(H,25,32)(H,26,28) |
| InChIKey | AVAMDIGYPBVMIQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|