C18H16F2N4O6S2 — CID 31760204
6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 31760204) has the molecular formula C18H16F2N4O6S2 and a molecular weight of 486.48 g/mol. Its IUPAC name is 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 31760204 |
| Molecular Formula | C18H16F2N4O6S2 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 6-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N3CCN(S(=O)(=O)c4c(F)cccc4F)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C18H16F2N4O6S2/c19-12-2-1-3-13(20)16(12)32(29,30)24-8-6-23(7-9-24)31(27,28)11-4-5-14-15(10-11)22-18(26)17(25)21-14/h1-5,10H,6-9H2,(H,21,25)(H,22,26) |
| InChIKey | SANZMXJMGGNCNN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|