C24H37N5O3S — CID 3176073
1-[3-(diethylamino)propyl]-3-[3-(dimethylamino)propyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea (PubChem CID 3176073) has the molecular formula C24H37N5O3S and a molecular weight of 475.66 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[3-(dimethylamino)propyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[3-(dimethylamino)propyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3176073 |
| Molecular Formula | C24H37N5O3S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[3-(dimethylamino)propyl]-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
| SMILES | CCN(CC)CCCN(Cc1cc2cc3c(cc2[nH]c1=O)OCO3)C(=S)NCCCN(C)C |
| InChI | InChI=1S/C24H37N5O3S/c1-5-28(6-2)11-8-12-29(24(33)25-9-7-10-27(3)4)16-19-13-18-14-21-22(32-17-31-21)15-20(18)26-23(19)30/h13-15H,5-12,16-17H2,1-4H3,(H,25,33)(H,26,30) |
| InChIKey | AJEHNNVDEZAAHB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|