C25H27N3O5S — CID 3176197
3-(4-methoxyphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 3176197) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(4-methoxyphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3176197 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2cc3cc4c(cc3[nH]c2=O)OCCO4)CC2CCCO2)cc1 |
| InChI | InChI=1S/C25H27N3O5S/c1-30-19-6-4-18(5-7-19)26-25(34)28(15-20-3-2-8-31-20)14-17-11-16-12-22-23(33-10-9-32-22)13-21(16)27-24(17)29/h4-7,11-13,20H,2-3,8-10,14-15H2,1H3,(H,26,34)(H,27,29) |
| InChIKey | XPEBJNPQYLMUKX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|