C24H36N4O4S — CID 3176337
1-[2-(diethylamino)ethyl]-3-(3-ethoxypropyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea (PubChem CID 3176337) has the molecular formula C24H36N4O4S and a molecular weight of 476.64 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-(3-ethoxypropyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-(3-ethoxypropyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3176337 |
| Molecular Formula | C24H36N4O4S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-(3-ethoxypropyl)-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]thiourea |
| SMILES | CCOCCCNC(=S)N(CCN(CC)CC)Cc1cc2cc3c(cc2[nH]c1=O)OCCO3 |
| InChI | InChI=1S/C24H36N4O4S/c1-4-27(5-2)9-10-28(24(33)25-8-7-11-30-6-3)17-19-14-18-15-21-22(32-13-12-31-21)16-20(18)26-23(19)29/h14-16H,4-13,17H2,1-3H3,(H,25,33)(H,26,29) |
| InChIKey | VKYBJFWQBNUBGE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|