C20H24N2O5S — CID 31767085
methyl 3-[methyl-[(2-morpholin-4-ylphenyl)methyl]sulfamoyl]benzoate (PubChem CID 31767085) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl 3-[methyl-[(2-morpholin-4-ylphenyl)methyl]sulfamoyl]benzoate.
| Compound Name | methyl 3-[methyl-[(2-morpholin-4-ylphenyl)methyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 31767085 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | methyl 3-[methyl-[(2-morpholin-4-ylphenyl)methyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N(C)Cc2ccccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C20H24N2O5S/c1-21(28(24,25)18-8-5-7-16(14-18)20(23)26-2)15-17-6-3-4-9-19(17)22-10-12-27-13-11-22/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | CNSPDMKVSIKIHF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |