C29H35N7O3 — CID 3176934
3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]-5,7-dimethyl-1H-quinolin-2-one (PubChem CID 3176934) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is 3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]-5,7-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]-5,7-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3176934 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 3-[[4-(4-methoxyphenyl)piperazin-1-yl]-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]-5,7-dimethyl-1H-quinolin-2-one |
| SMILES | COc1ccc(N2CCN(C(c3cc4c(C)cc(C)cc4[nH]c3=O)c3nnnn3CC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C29H35N7O3/c1-19-15-20(2)24-17-25(29(37)30-26(24)16-19)27(28-31-32-33-36(28)18-23-5-4-14-39-23)35-12-10-34(11-13-35)21-6-8-22(38-3)9-7-21/h6-9,15-17,23,27H,4-5,10-14,18H2,1-3H3,(H,30,37) |
| InChIKey | XCUMOWSHSDKMQI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|