About 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide
3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide (PubChem CID 31776553) has the molecular formula C21H20Cl2N4O4S
and a molecular weight of 495.39 g/mol. Its IUPAC name is 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide |
| PubChem CID | 31776553 |
| Molecular Formula | C21H20Cl2N4O4S |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)c1 |
| InChI | InChI=1S/C21H20Cl2N4O4S/c1-3-26(4-2)20(28)14-6-5-7-15(12-14)25-32(30,31)17-10-8-16(9-11-17)27-21(29)19(23)18(22)13-24-27/h5-13,25H,3-4H2,1-2H3 |
| InChIKey | DNVFFLYZCPRBOT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide?
The IUPAC name of 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide (CID 31776553) is 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide.
What is the SMILES notation for 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide?
The canonical SMILES for 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide is CCN(CC)C(=O)c1cccc(NS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)c1.
What is the InChIKey of 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide?
The InChIKey is DNVFFLYZCPRBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2N4O4S/c1-3-26(4-2)20(28)14-6-5-7-15(12-14)25-32(30,31)17-10-8-16(9-11-17)27-21(29)19(23)18(22)13-24-27/h5-13,25H,3-4H2,1-2H3.
What are the key properties of 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide?
3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide has a molecular weight of 495.39 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]-N,N-diethylbenzamide is sourced from PubChem (CID 31776553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).