C15H12BrClN2O4S — CID 31777718
3-bromo-5-chloro-N-[4-(cyanomethoxy)phenyl]-2-methoxybenzenesulfonamide (PubChem CID 31777718) has the molecular formula C15H12BrClN2O4S and a molecular weight of 431.70 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[4-(cyanomethoxy)phenyl]-2-methoxybenzenesulfonamide.
| Compound Name | 3-bromo-5-chloro-N-[4-(cyanomethoxy)phenyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 31777718 |
| Molecular Formula | C15H12BrClN2O4S |
| Molecular Weight | 431.70 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 3-bromo-5-chloro-N-[4-(cyanomethoxy)phenyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1c(Br)cc(Cl)cc1S(=O)(=O)Nc1ccc(OCC#N)cc1 |
| InChI | InChI=1S/C15H12BrClN2O4S/c1-22-15-13(16)8-10(17)9-14(15)24(20,21)19-11-2-4-12(5-3-11)23-7-6-18/h2-5,8-9,19H,7H2,1H3 |
| InChIKey | SDZRTQXNVYVHRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |