About 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one
1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one (PubChem CID 31781728) has the molecular formula C15H10FN5O2S
and a molecular weight of 343.34 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one.
Molecular Properties
| Compound Name | 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one |
| PubChem CID | 31781728 |
| Molecular Formula | C15H10FN5O2S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one |
| SMILES | O=c1n(Cc2coc(-c3ccc(F)cc3)n2)nnn1-c1cccs1 |
| InChI | InChI=1S/C15H10FN5O2S/c16-11-5-3-10(4-6-11)14-17-12(9-23-14)8-20-15(22)21(19-18-20)13-2-1-7-24-13/h1-7,9H,8H2 |
| InChIKey | BWSASTPZKYRMPZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one?
The IUPAC name of 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one (CID 31781728) is 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one.
What is the SMILES notation for 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one?
The canonical SMILES for 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one is O=c1n(Cc2coc(-c3ccc(F)cc3)n2)nnn1-c1cccs1.
What is the InChIKey of 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one?
The InChIKey is BWSASTPZKYRMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN5O2S/c16-11-5-3-10(4-6-11)14-17-12(9-23-14)8-20-15(22)21(19-18-20)13-2-1-7-24-13/h1-7,9H,8H2.
What are the key properties of 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one?
1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one has a molecular weight of 343.34 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-thiophen-2-yltetrazol-5-one is sourced from PubChem (CID 31781728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).