C26H36N2O2 — CID 31784528
N-[2-[cyclopropyl-[(4-propan-2-ylphenyl)methyl]amino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 31784528) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[2-[cyclopropyl-[(4-propan-2-ylphenyl)methyl]amino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[cyclopropyl-[(4-propan-2-ylphenyl)methyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 31784528 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | N-[2-[cyclopropyl-[(4-propan-2-ylphenyl)methyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | CC(C)c1ccc(CN(C(=O)CNC(=O)C23CC4CC(CC(C4)C2)C3)C2CC2)cc1 |
| InChI | InChI=1S/C26H36N2O2/c1-17(2)22-5-3-18(4-6-22)16-28(23-7-8-23)24(29)15-27-25(30)26-12-19-9-20(13-26)11-21(10-19)14-26/h3-6,17,19-21,23H,7-16H2,1-2H3,(H,27,30) |
| InChIKey | SNDMLXDEUKIWMQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |