About 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole
1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole (PubChem CID 31788167) has the molecular formula C14H9ClF2N2
and a molecular weight of 278.69 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole.
Molecular Properties
| Compound Name | 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole |
| PubChem CID | 31788167 |
| Molecular Formula | C14H9ClF2N2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole |
| SMILES | Fc1cc2ncn(Cc3ccccc3Cl)c2cc1F |
| InChI | InChI=1S/C14H9ClF2N2/c15-10-4-2-1-3-9(10)7-19-8-18-13-5-11(16)12(17)6-14(13)19/h1-6,8H,7H2 |
| InChIKey | RJFZWGOQWFVKAP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole?
The IUPAC name of 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole (CID 31788167) is 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole.
What is the SMILES notation for 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole?
The canonical SMILES for 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole is Fc1cc2ncn(Cc3ccccc3Cl)c2cc1F.
What is the InChIKey of 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole?
The InChIKey is RJFZWGOQWFVKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClF2N2/c15-10-4-2-1-3-9(10)7-19-8-18-13-5-11(16)12(17)6-14(13)19/h1-6,8H,7H2.
What are the key properties of 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole?
1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole has a molecular weight of 278.69 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chlorophenyl)methyl]-5,6-difluorobenzimidazole is sourced from PubChem (CID 31788167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).