C26H33FN6O4 — CID 3178953
N-tert-butyl-2-[3-ethoxypropyl-[2-[5-(4-fluorophenyl)tetrazol-2-yl]acetyl]amino]-2-(4-hydroxyphenyl)acetamide (PubChem CID 3178953) has the molecular formula C26H33FN6O4 and a molecular weight of 512.59 g/mol. Its IUPAC name is N-tert-butyl-2-[3-ethoxypropyl-[2-[5-(4-fluorophenyl)tetrazol-2-yl]acetyl]amino]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-tert-butyl-2-[3-ethoxypropyl-[2-[5-(4-fluorophenyl)tetrazol-2-yl]acetyl]amino]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 3178953 |
| Molecular Formula | C26H33FN6O4 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-tert-butyl-2-[3-ethoxypropyl-[2-[5-(4-fluorophenyl)tetrazol-2-yl]acetyl]amino]-2-(4-hydroxyphenyl)acetamide |
| SMILES | CCOCCCN(C(=O)Cn1nnc(-c2ccc(F)cc2)n1)C(C(=O)NC(C)(C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C26H33FN6O4/c1-5-37-16-6-15-32(23(25(36)28-26(2,3)4)18-9-13-21(34)14-10-18)22(35)17-33-30-24(29-31-33)19-7-11-20(27)12-8-19/h7-14,23,34H,5-6,15-17H2,1-4H3,(H,28,36) |
| InChIKey | BHNDBKRNRUXPKE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|