C19H18FN3O3 — CID 31794745
2-fluoro-N'-[4-(2-oxopiperidin-1-yl)benzoyl]benzohydrazide (PubChem CID 31794745) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-fluoro-N'-[4-(2-oxopiperidin-1-yl)benzoyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[4-(2-oxopiperidin-1-yl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 31794745 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-fluoro-N'-[4-(2-oxopiperidin-1-yl)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C19H18FN3O3/c20-16-6-2-1-5-15(16)19(26)22-21-18(25)13-8-10-14(11-9-13)23-12-4-3-7-17(23)24/h1-2,5-6,8-11H,3-4,7,12H2,(H,21,25)(H,22,26) |
| InChIKey | ATBAJLHTGFHIIH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|