C27H28N4O3S — CID 31798787
N-[(1-benzylpyrazol-4-yl)methyl]-5-(benzylsulfamoyl)-N,2-dimethylbenzamide (PubChem CID 31798787) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-5-(benzylsulfamoyl)-N,2-dimethylbenzamide.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-5-(benzylsulfamoyl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 31798787 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-5-(benzylsulfamoyl)-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccccc2)cc1C(=O)N(C)Cc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H28N4O3S/c1-21-13-14-25(35(33,34)29-17-22-9-5-3-6-10-22)15-26(21)27(32)30(2)18-24-16-28-31(20-24)19-23-11-7-4-8-12-23/h3-16,20,29H,17-19H2,1-2H3 |
| InChIKey | ZNLALYCVBQBRHB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |