C24H30N6O3 — CID 3179899
2-[benzyl-[2-[5-(5-methylfuran-2-yl)tetrazol-2-yl]acetyl]amino]-N-cyclopentylbutanamide (PubChem CID 3179899) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[benzyl-[2-[5-(5-methylfuran-2-yl)tetrazol-2-yl]acetyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[benzyl-[2-[5-(5-methylfuran-2-yl)tetrazol-2-yl]acetyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 3179899 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 2-[benzyl-[2-[5-(5-methylfuran-2-yl)tetrazol-2-yl]acetyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccccc1)C(=O)Cn1nnc(-c2ccc(C)o2)n1 |
| InChI | InChI=1S/C24H30N6O3/c1-3-20(24(32)25-19-11-7-8-12-19)29(15-18-9-5-4-6-10-18)22(31)16-30-27-23(26-28-30)21-14-13-17(2)33-21/h4-6,9-10,13-14,19-20H,3,7-8,11-12,15-16H2,1-2H3,(H,25,32) |
| InChIKey | BEAUWMPCSYSCLL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |