C21H17NO5S — CID 31803226
[2-(4-methylphenyl)-2-oxoethyl] 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate (PubChem CID 31803226) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate |
|---|---|
| PubChem CID | 31803226 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetate |
| SMILES | Cc1ccc(C(=O)COC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)cc1 |
| InChI | InChI=1S/C21H17NO5S/c1-14-8-10-15(11-9-14)18(23)13-27-20(24)12-22-17-6-2-4-16-5-3-7-19(21(16)17)28(22,25)26/h2-11H,12-13H2,1H3 |
| InChIKey | IJZHVJNRKATNFZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |