About (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate
(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate (PubChem CID 31805555) has the molecular formula C21H18FNO4
and a molecular weight of 367.38 g/mol. Its IUPAC name is (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate.
Molecular Properties
| Compound Name | (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate |
| PubChem CID | 31805555 |
| Molecular Formula | C21H18FNO4 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate |
| SMILES | O=C(CCc1ccc2ccccc2n1)OCc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C21H18FNO4/c22-17-9-15-11-25-13-27-21(15)16(10-17)12-26-20(24)8-7-18-6-5-14-3-1-2-4-19(14)23-18/h1-6,9-10H,7-8,11-13H2 |
| InChIKey | RRCHBLWWTNEWOH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate?
The IUPAC name of (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate (CID 31805555) is (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate.
What is the SMILES notation for (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate?
The canonical SMILES for (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate is O=C(CCc1ccc2ccccc2n1)OCc1cc(F)cc2c1OCOC2.
What is the InChIKey of (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate?
The InChIKey is RRCHBLWWTNEWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18FNO4/c22-17-9-15-11-25-13-27-21(15)16(10-17)12-26-20(24)8-7-18-6-5-14-3-1-2-4-19(14)23-18/h1-6,9-10H,7-8,11-13H2.
What are the key properties of (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate?
(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate has a molecular weight of 367.38 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-4H-1,3-benzodioxin-8-yl)methyl 3-quinolin-2-ylpropanoate is sourced from PubChem (CID 31805555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).