About methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate
methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate (PubChem CID 31808227) has the molecular formula C12H8BrF2NO4S2
and a molecular weight of 412.23 g/mol. Its IUPAC name is methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate |
| PubChem CID | 31808227 |
| Molecular Formula | C12H8BrF2NO4S2 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 410.90 |
| IUPAC Name | methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccc(Br)s2)c(F)cc1F |
| InChI | InChI=1S/C12H8BrF2NO4S2/c1-20-12(17)6-4-9(8(15)5-7(6)14)16-22(18,19)11-3-2-10(13)21-11/h2-5,16H,1H3 |
| InChIKey | JTAMZBPSGVOZAH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate?
The IUPAC name of methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate (CID 31808227) is methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate.
What is the SMILES notation for methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate?
The canonical SMILES for methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate is COC(=O)c1cc(NS(=O)(=O)c2ccc(Br)s2)c(F)cc1F.
What is the InChIKey of methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate?
The InChIKey is JTAMZBPSGVOZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrF2NO4S2/c1-20-12(17)6-4-9(8(15)5-7(6)14)16-22(18,19)11-3-2-10(13)21-11/h2-5,16H,1H3.
What are the key properties of methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate?
methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate has a molecular weight of 412.23 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(5-bromothiophen-2-yl)sulfonylamino]-2,4-difluorobenzoate is sourced from PubChem (CID 31808227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).