C17H20ClF3N2O2 — CID 31816573
N-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide (PubChem CID 31816573) has the molecular formula C17H20ClF3N2O2 and a molecular weight of 376.81 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31816573 |
| Molecular Formula | C17H20ClF3N2O2 |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H20ClF3N2O2/c1-10(2)16(25)23-7-5-11(6-8-23)15(24)22-12-3-4-14(18)13(9-12)17(19,20)21/h3-4,9-11H,5-8H2,1-2H3,(H,22,24) |
| InChIKey | DADUYGJETDJQPL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |