About 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide
3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide (PubChem CID 31820934) has the molecular formula C16H18N2O4S2
and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide.
Molecular Properties
| Compound Name | 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide |
| PubChem CID | 31820934 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)N(Cc2ccccc2)C2CC2)c1 |
| InChI | InChI=1S/C16H18N2O4S2/c17-23(19,20)15-7-4-8-16(11-15)24(21,22)18(14-9-10-14)12-13-5-2-1-3-6-13/h1-8,11,14H,9-10,12H2,(H2,17,19,20) |
| InChIKey | WNSWIWMPIYTRRT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide?
The IUPAC name of 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide (CID 31820934) is 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide.
What is the SMILES notation for 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide?
The canonical SMILES for 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide is NS(=O)(=O)c1cccc(S(=O)(=O)N(Cc2ccccc2)C2CC2)c1.
What is the InChIKey of 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide?
The InChIKey is WNSWIWMPIYTRRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4S2/c17-23(19,20)15-7-4-8-16(11-15)24(21,22)18(14-9-10-14)12-13-5-2-1-3-6-13/h1-8,11,14H,9-10,12H2,(H2,17,19,20).
What are the key properties of 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide?
3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide has a molecular weight of 366.46 g/mol, XLogP of 1.69, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-benzyl-3-N-cyclopropylbenzene-1,3-disulfonamide is sourced from PubChem (CID 31820934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).