C20H20N2O5 — CID 31826431
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 31826431) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 31826431 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)c3cc(-c4ccco4)on3)c2O1 |
| InChI | InChI=1S/C20H20N2O5/c1-20(2)12-13-5-3-6-16(18(13)26-20)25-10-8-21-19(23)14-11-17(27-22-14)15-7-4-9-24-15/h3-7,9,11H,8,10,12H2,1-2H3,(H,21,23) |
| InChIKey | YKPBYNJZYMRCSP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|