C29H35N7O2 — CID 3183279
3-[(1-benzyltetrazol-5-yl)-(4-cyclohexylpiperazin-1-yl)methyl]-7-methoxy-1H-quinolin-2-one (PubChem CID 3183279) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 3-[(1-benzyltetrazol-5-yl)-(4-cyclohexylpiperazin-1-yl)methyl]-7-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[(1-benzyltetrazol-5-yl)-(4-cyclohexylpiperazin-1-yl)methyl]-7-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3183279 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 3-[(1-benzyltetrazol-5-yl)-(4-cyclohexylpiperazin-1-yl)methyl]-7-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2cc(C(c3nnnn3Cc3ccccc3)N3CCN(C4CCCCC4)CC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C29H35N7O2/c1-38-24-13-12-22-18-25(29(37)30-26(22)19-24)27(28-31-32-33-36(28)20-21-8-4-2-5-9-21)35-16-14-34(15-17-35)23-10-6-3-7-11-23/h2,4-5,8-9,12-13,18-19,23,27H,3,6-7,10-11,14-17,20H2,1H3,(H,30,37) |
| InChIKey | DGGDVMLSNCQZHT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |