C19H16N2O2S2 — CID 31837477
2-(2-cyanophenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide (PubChem CID 31837477) has the molecular formula C19H16N2O2S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 31837477 |
| Molecular Formula | C19H16N2O2S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-(2-cyanophenoxy)-N,N-bis(thiophen-2-ylmethyl)acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C19H16N2O2S2/c20-11-15-5-1-2-8-18(15)23-14-19(22)21(12-16-6-3-9-24-16)13-17-7-4-10-25-17/h1-10H,12-14H2 |
| InChIKey | IIBNPUNCYCMOHC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |