About methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate
methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate (PubChem CID 31840125) has the molecular formula C17H26N2O5S
and a molecular weight of 370.47 g/mol. Its IUPAC name is methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate.
Molecular Properties
| Compound Name | methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate |
| PubChem CID | 31840125 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCCCCCC(=O)OC)cc(C)c1C |
| InChI | InChI=1S/C17H26N2O5S/c1-12-10-14(11-15(13(12)2)25(22,23)18-3)17(21)19-9-7-5-6-8-16(20)24-4/h10-11,18H,5-9H2,1-4H3,(H,19,21) |
| InChIKey | VKSLICMZDZYOBO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate?
The IUPAC name of methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate (CID 31840125) is methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate.
What is the SMILES notation for methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate?
The canonical SMILES for methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate is CNS(=O)(=O)c1cc(C(=O)NCCCCCC(=O)OC)cc(C)c1C.
What is the InChIKey of methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate?
The InChIKey is VKSLICMZDZYOBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O5S/c1-12-10-14(11-15(13(12)2)25(22,23)18-3)17(21)19-9-7-5-6-8-16(20)24-4/h10-11,18H,5-9H2,1-4H3,(H,19,21).
What are the key properties of methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate?
methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate has a molecular weight of 370.47 g/mol, XLogP of 1.67, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[3,4-dimethyl-5-(methylsulfamoyl)benzoyl]amino]hexanoate is sourced from PubChem (CID 31840125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).