C18H20N4O3 — CID 31852932
(2R)-N-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]propanamide (PubChem CID 31852932) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2R)-N-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]propanamide.
| Compound Name | (2R)-N-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 31852932 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2R)-N-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-methylpyrazol-4-yl)methyl]propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N([C@H](C)C(=O)N(C)Cc1cnn(C)c1)C2=O |
| InChI | InChI=1S/C18H20N4O3/c1-11-5-6-14-15(7-11)18(25)22(17(14)24)12(2)16(23)20(3)9-13-8-19-21(4)10-13/h5-8,10,12H,9H2,1-4H3/t12-/m1/s1 |
| InChIKey | BZAJOHGBFFTTEL-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|