About 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one
4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one (PubChem CID 3186986) has the molecular formula C21H16N2O3S
and a molecular weight of 376.44 g/mol. Its IUPAC name is 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one |
| PubChem CID | 3186986 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one |
| SMILES | Cc1cc2cc3c(cc2nc1SCc1cc(=O)[nH]c2ccccc12)OCO3 |
| InChI | InChI=1S/C21H16N2O3S/c1-12-6-13-7-18-19(26-11-25-18)9-17(13)23-21(12)27-10-14-8-20(24)22-16-5-3-2-4-15(14)16/h2-9H,10-11H2,1H3,(H,22,24) |
| InChIKey | CTRRHKANAIPVPP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one?
The IUPAC name of 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one (CID 3186986) is 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one.
What is the SMILES notation for 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one?
The canonical SMILES for 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one is Cc1cc2cc3c(cc2nc1SCc1cc(=O)[nH]c2ccccc12)OCO3.
What is the InChIKey of 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one?
The InChIKey is CTRRHKANAIPVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3S/c1-12-6-13-7-18-19(26-11-25-18)9-17(13)23-21(12)27-10-14-8-20(24)22-16-5-3-2-4-15(14)16/h2-9H,10-11H2,1H3,(H,22,24).
What are the key properties of 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one?
4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one has a molecular weight of 376.44 g/mol, XLogP of 4.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-methyl-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanylmethyl]-1H-quinolin-2-one is sourced from PubChem (CID 3186986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).