C25H26N2O3 — CID 31870263
N-[(1R)-1-(3-benzamidophenyl)ethyl]-3-methoxy-N,4-dimethylbenzamide (PubChem CID 31870263) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-[(1R)-1-(3-benzamidophenyl)ethyl]-3-methoxy-N,4-dimethylbenzamide.
| Compound Name | N-[(1R)-1-(3-benzamidophenyl)ethyl]-3-methoxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 31870263 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-[(1R)-1-(3-benzamidophenyl)ethyl]-3-methoxy-N,4-dimethylbenzamide |
| SMILES | COc1cc(C(=O)N(C)[C@H](C)c2cccc(NC(=O)c3ccccc3)c2)ccc1C |
| InChI | InChI=1S/C25H26N2O3/c1-17-13-14-21(16-23(17)30-4)25(29)27(3)18(2)20-11-8-12-22(15-20)26-24(28)19-9-6-5-7-10-19/h5-16,18H,1-4H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | OLYWNOINJDWXDA-GOSISDBHSA-N |
| XLogP | 5.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |