C21H14F3N3O2 — CID 31871947
4-cyano-2-methyl-5-pyrrol-1-yl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-3-carboxamide (PubChem CID 31871947) has the molecular formula C21H14F3N3O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 4-cyano-2-methyl-5-pyrrol-1-yl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-3-carboxamide.
| Compound Name | 4-cyano-2-methyl-5-pyrrol-1-yl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 31871947 |
| Molecular Formula | C21H14F3N3O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-cyano-2-methyl-5-pyrrol-1-yl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]furan-3-carboxamide |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F3N3O2/c1-14-18(17(13-25)20(29-14)27-10-2-3-11-27)19(28)26-9-5-7-15-6-4-8-16(12-15)21(22,23)24/h2-4,6,8,10-12H,9H2,1H3,(H,26,28) |
| InChIKey | UDDITQNNKPMVRK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|