About [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate
[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate (PubChem CID 31874945) has the molecular formula C21H26N2O3S
and a molecular weight of 386.52 g/mol. Its IUPAC name is [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate |
| PubChem CID | 31874945 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate |
| SMILES | C[C@H](OC(=O)C1(Cc2nc3ccccc3s2)CCCC1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15(19(24)23-12-6-7-13-23)26-20(25)21(10-4-5-11-21)14-18-22-16-8-2-3-9-17(16)27-18/h2-3,8-9,15H,4-7,10-14H2,1H3/t15-/m0/s1 |
| InChIKey | YKYIHDPWUXTDKJ-HNNXBMFYSA-N |
| XLogP | 3.95 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate?
The IUPAC name of [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate (CID 31874945) is [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate.
What is the SMILES notation for [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate?
The canonical SMILES for [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate is C[C@H](OC(=O)C1(Cc2nc3ccccc3s2)CCCC1)C(=O)N1CCCC1.
What is the InChIKey of [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate?
The InChIKey is YKYIHDPWUXTDKJ-HNNXBMFYSA-N. The full InChI is InChI=1S/C21H26N2O3S/c1-15(19(24)23-12-6-7-13-23)26-20(25)21(10-4-5-11-21)14-18-22-16-8-2-3-9-17(16)27-18/h2-3,8-9,15H,4-7,10-14H2,1H3/t15-/m0/s1.
What are the key properties of [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate?
[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate has a molecular weight of 386.52 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 1-(1,3-benzothiazol-2-ylmethyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 31874945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).