C19H25N3O2 — CID 31882313
(5R)-3-[[4-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5-propylimidazolidine-2,4-dione (PubChem CID 31882313) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (5R)-3-[[4-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[4-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31882313 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (5R)-3-[[4-(4-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@H]1NC(=O)N(CN2CC=C(c3ccc(C)cc3)CC2)C1=O |
| InChI | InChI=1S/C19H25N3O2/c1-3-4-17-18(23)22(19(24)20-17)13-21-11-9-16(10-12-21)15-7-5-14(2)6-8-15/h5-9,17H,3-4,10-13H2,1-2H3,(H,20,24)/t17-/m1/s1 |
| InChIKey | LCAPIGYCKFUYDG-QGZVFWFLSA-N |
| XLogP | 2.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|