C17H17NO6 — CID 31885361
1-(2,4-dimethoxyphenyl)-2-(5-methyl-2-nitrophenoxy)ethanone (PubChem CID 31885361) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(5-methyl-2-nitrophenoxy)ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(5-methyl-2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 31885361 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(5-methyl-2-nitrophenoxy)ethanone |
| SMILES | COc1ccc(C(=O)COc2cc(C)ccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C17H17NO6/c1-11-4-7-14(18(20)21)17(8-11)24-10-15(19)13-6-5-12(22-2)9-16(13)23-3/h4-9H,10H2,1-3H3 |
| InChIKey | IYJOAWKECVVBNG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|