C18H23N3O3 — CID 31890180
N-(3-butoxypropyl)-6-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 31890180) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(3-butoxypropyl)-6-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-(3-butoxypropyl)-6-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 31890180 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(3-butoxypropyl)-6-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1ccc(=O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H23N3O3/c1-2-3-13-24-14-7-12-19-18(23)16-10-11-17(22)21(20-16)15-8-5-4-6-9-15/h4-6,8-11H,2-3,7,12-14H2,1H3,(H,19,23) |
| InChIKey | SAYFFOOESRLXPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|