C17H14ClFN2O2S — CID 3189701
3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)propanamide (PubChem CID 3189701) has the molecular formula C17H14ClFN2O2S and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 3189701 |
| Molecular Formula | C17H14ClFN2O2S |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 3-chloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(furan-2-ylmethyl)propanamide |
| SMILES | O=C(CCCl)N(Cc1ccco1)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C17H14ClFN2O2S/c18-8-7-16(22)21(10-14-2-1-9-23-14)17-20-15(11-24-17)12-3-5-13(19)6-4-12/h1-6,9,11H,7-8,10H2 |
| InChIKey | SJJJFTSCPONHQA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|