About 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide
1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide (PubChem CID 3189842) has the molecular formula C21H30N2O5S2
and a molecular weight of 454.61 g/mol. Its IUPAC name is 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide.
Molecular Properties
| Compound Name | 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide |
| PubChem CID | 3189842 |
| Molecular Formula | C21H30N2O5S2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(S(=O)(=O)N(Cc2ccc(C)o2)C2CCCC2)cc1 |
| InChI | InChI=1S/C21H30N2O5S2/c1-4-16(2)22-29(24,25)20-11-13-21(14-12-20)30(26,27)23(18-7-5-6-8-18)15-19-10-9-17(3)28-19/h9-14,16,18,22H,4-8,15H2,1-3H3 |
| InChIKey | WMYBHYRCDRMMRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide?
The IUPAC name of 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide (CID 3189842) is 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide.
What is the SMILES notation for 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide?
The canonical SMILES for 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide is CCC(C)NS(=O)(=O)c1ccc(S(=O)(=O)N(Cc2ccc(C)o2)C2CCCC2)cc1.
What is the InChIKey of 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide?
The InChIKey is WMYBHYRCDRMMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O5S2/c1-4-16(2)22-29(24,25)20-11-13-21(14-12-20)30(26,27)23(18-7-5-6-8-18)15-19-10-9-17(3)28-19/h9-14,16,18,22H,4-8,15H2,1-3H3.
What are the key properties of 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide?
1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide has a molecular weight of 454.61 g/mol, XLogP of 3.80, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-butan-2-yl-4-N-cyclopentyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-disulfonamide is sourced from PubChem (CID 3189842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).