C26H25N7O2S — CID 31905556
2-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-1-phenyl-4,5,6,7-tetrahydroindol-2-yl)acetamide (PubChem CID 31905556) has the molecular formula C26H25N7O2S and a molecular weight of 499.60 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-1-phenyl-4,5,6,7-tetrahydroindol-2-yl)acetamide.
| Compound Name | 2-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-1-phenyl-4,5,6,7-tetrahydroindol-2-yl)acetamide |
|---|---|
| PubChem CID | 31905556 |
| Molecular Formula | C26H25N7O2S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[[4-amino-5-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-1-phenyl-4,5,6,7-tetrahydroindol-2-yl)acetamide |
| SMILES | COc1ccccc1-c1nnc(SCC(=O)Nc2c(C#N)c3c(n2-c2ccccc2)CCCC3)n1N |
| InChI | InChI=1S/C26H25N7O2S/c1-35-22-14-8-6-12-19(22)25-30-31-26(33(25)28)36-16-23(34)29-24-20(15-27)18-11-5-7-13-21(18)32(24)17-9-3-2-4-10-17/h2-4,6,8-10,12,14H,5,7,11,13,16,28H2,1H3,(H,29,34) |
| InChIKey | GOCZPFXWLWAEBZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |