C18H22N6O2S2 — CID 3190566
2-[[5-[(2-anilino-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3190566) has the molecular formula C18H22N6O2S2 and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-[[5-[(2-anilino-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-[(2-anilino-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3190566 |
| Molecular Formula | C18H22N6O2S2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[[5-[(2-anilino-1,3-thiazol-4-yl)methyl]-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COCCCn1c(Cc2csc(Nc3ccccc3)n2)nnc1SCC(N)=O |
| InChI | InChI=1S/C18H22N6O2S2/c1-26-9-5-8-24-16(22-23-18(24)28-12-15(19)25)10-14-11-27-17(21-14)20-13-6-3-2-4-7-13/h2-4,6-7,11H,5,8-10,12H2,1H3,(H2,19,25)(H,20,21) |
| InChIKey | HZPARVRXGLIIIO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|